C18H18F2N2O3 — CID 95597018
N-(3,5-difluorophenyl)-N'-[(1S)-1-(4-methoxyphenyl)propyl]oxamide (PubChem CID 95597018) has the molecular formula C18H18F2N2O3 and a molecular weight of 348.35 g/mol. Its IUPAC name is N-(3,5-difluorophenyl)-N'-[(1S)-1-(4-methoxyphenyl)propyl]oxamide.
| Compound Name | N-(3,5-difluorophenyl)-N'-[(1S)-1-(4-methoxyphenyl)propyl]oxamide |
|---|---|
| PubChem CID | 95597018 |
| Molecular Formula | C18H18F2N2O3 |
| Molecular Weight | 348.35 g/mol |
| Exact Mass | 348.13 |
| IUPAC Name | N-(3,5-difluorophenyl)-N'-[(1S)-1-(4-methoxyphenyl)propyl]oxamide |
| SMILES | CC[C@H](NC(=O)C(=O)Nc1cc(F)cc(F)c1)c1ccc(OC)cc1 |
| InChI | InChI=1S/C18H18F2N2O3/c1-3-16(11-4-6-15(25-2)7-5-11)22-18(24)17(23)21-14-9-12(19)8-13(20)10-14/h4-10,16H,3H2,1-2H3,(H,21,23)(H,22,24)/t16-/m0/s1 |
| InChIKey | BRRUKWIAWKZDFY-INIZCTEOSA-N |
| XLogP | 3.18 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.35 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|