C24H23N3O3 — CID 40972028
N-[(1S)-1,2-bis(4-methoxyphenyl)ethyl]imidazo[1,2-a]pyridine-2-carboxamide (PubChem CID 40972028) has the molecular formula C24H23N3O3 and a molecular weight of 401.47 g/mol. Its IUPAC name is N-[(1S)-1,2-bis(4-methoxyphenyl)ethyl]imidazo[1,2-a]pyridine-2-carboxamide.
| Compound Name | N-[(1S)-1,2-bis(4-methoxyphenyl)ethyl]imidazo[1,2-a]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 40972028 |
| Molecular Formula | C24H23N3O3 |
| Molecular Weight | 401.47 g/mol |
| Exact Mass | 401.17 |
| IUPAC Name | N-[(1S)-1,2-bis(4-methoxyphenyl)ethyl]imidazo[1,2-a]pyridine-2-carboxamide |
| SMILES | COc1ccc(C[C@H](NC(=O)c2cn3ccccc3n2)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C24H23N3O3/c1-29-19-10-6-17(7-11-19)15-21(18-8-12-20(30-2)13-9-18)26-24(28)22-16-27-14-4-3-5-23(27)25-22/h3-14,16,21H,15H2,1-2H3,(H,26,28)/t21-/m0/s1 |
| InChIKey | SHPPQTAHUFFJBJ-NRFANRHFSA-N |
| XLogP | 4.07 |
| TPSA | 64.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.47 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |