C18H15N5S — CID 9151035
N-(2-methylsulfanyl-6-phenylpyrimidin-4-yl)-1H-indazol-6-amine (PubChem CID 9151035) has the molecular formula C18H15N5S and a molecular weight of 333.42 g/mol. Its IUPAC name is N-(2-methylsulfanyl-6-phenylpyrimidin-4-yl)-1H-indazol-6-amine.
| Compound Name | N-(2-methylsulfanyl-6-phenylpyrimidin-4-yl)-1H-indazol-6-amine |
|---|---|
| PubChem CID | 9151035 |
| Molecular Formula | C18H15N5S |
| Molecular Weight | 333.42 g/mol |
| Exact Mass | 333.10 |
| IUPAC Name | N-(2-methylsulfanyl-6-phenylpyrimidin-4-yl)-1H-indazol-6-amine |
| SMILES | CSc1nc(Nc2ccc3cn[nH]c3c2)cc(-c2ccccc2)n1 |
| InChI | InChI=1S/C18H15N5S/c1-24-18-21-15(12-5-3-2-4-6-12)10-17(22-18)20-14-8-7-13-11-19-23-16(13)9-14/h2-11H,1H3,(H,19,23)(H,20,21,22) |
| InChIKey | NPQZLCRSVZPUCR-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 66.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.42 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |