C15H16N6O2S — CID 505746
N-(2-hydroxyethyl)-4-(1H-indazol-6-ylamino)-2-methylsulfanylpyrimidine-5-carboxamide (PubChem CID 505746) has the molecular formula C15H16N6O2S and a molecular weight of 344.40 g/mol. Its IUPAC name is N-(2-hydroxyethyl)-4-(1H-indazol-6-ylamino)-2-methylsulfanylpyrimidine-5-carboxamide.
| Compound Name | N-(2-hydroxyethyl)-4-(1H-indazol-6-ylamino)-2-methylsulfanylpyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 505746 |
| Molecular Formula | C15H16N6O2S |
| Molecular Weight | 344.40 g/mol |
| Exact Mass | 344.11 |
| IUPAC Name | N-(2-hydroxyethyl)-4-(1H-indazol-6-ylamino)-2-methylsulfanylpyrimidine-5-carboxamide |
| SMILES | CSc1ncc(C(=O)NCCO)c(Nc2ccc3cn[nH]c3c2)n1 |
| InChI | InChI=1S/C15H16N6O2S/c1-24-15-17-8-11(14(23)16-4-5-22)13(20-15)19-10-3-2-9-7-18-21-12(9)6-10/h2-3,6-8,22H,4-5H2,1H3,(H,16,23)(H,18,21)(H,17,19,20) |
| InChIKey | MVCVFABXKBJEGA-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 115.82 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.40 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |