C18H15FN4O2S — CID 91453117
N-(4-fluorophenyl)-4-(3-hydroxyanilino)-2-methylsulfanylpyrimidine-5-carboxamide (PubChem CID 91453117) has the molecular formula C18H15FN4O2S and a molecular weight of 370.41 g/mol. Its IUPAC name is N-(4-fluorophenyl)-4-(3-hydroxyanilino)-2-methylsulfanylpyrimidine-5-carboxamide.
| Compound Name | N-(4-fluorophenyl)-4-(3-hydroxyanilino)-2-methylsulfanylpyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 91453117 |
| Molecular Formula | C18H15FN4O2S |
| Molecular Weight | 370.41 g/mol |
| Exact Mass | 370.09 |
| IUPAC Name | N-(4-fluorophenyl)-4-(3-hydroxyanilino)-2-methylsulfanylpyrimidine-5-carboxamide |
| SMILES | CSc1ncc(C(=O)Nc2ccc(F)cc2)c(Nc2cccc(O)c2)n1 |
| InChI | InChI=1S/C18H15FN4O2S/c1-26-18-20-10-15(17(25)22-12-7-5-11(19)6-8-12)16(23-18)21-13-3-2-4-14(24)9-13/h2-10,24H,1H3,(H,22,25)(H,20,21,23) |
| InChIKey | BZVVRPZQDSMRSX-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 87.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.41 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |