C19H16N4O4 — CID 23883210
2-[[6-(2-carboxyanilino)-3-methylpyridazin-4-yl]amino]benzoic acid (PubChem CID 23883210) has the molecular formula C19H16N4O4 and a molecular weight of 364.36 g/mol. Its IUPAC name is 2-[[6-(2-carboxyanilino)-3-methylpyridazin-4-yl]amino]benzoic acid.
| Compound Name | 2-[[6-(2-carboxyanilino)-3-methylpyridazin-4-yl]amino]benzoic acid |
|---|---|
| PubChem CID | 23883210 |
| Molecular Formula | C19H16N4O4 |
| Molecular Weight | 364.36 g/mol |
| Exact Mass | 364.12 |
| IUPAC Name | 2-[[6-(2-carboxyanilino)-3-methylpyridazin-4-yl]amino]benzoic acid |
| SMILES | Cc1nnc(Nc2ccccc2C(=O)O)cc1Nc1ccccc1C(=O)O |
| InChI | InChI=1S/C19H16N4O4/c1-11-16(20-14-8-4-2-6-12(14)18(24)25)10-17(23-22-11)21-15-9-5-3-7-13(15)19(26)27/h2-10H,1H3,(H,24,25)(H,26,27)(H2,20,21,23) |
| InChIKey | BJMOOBKPUOPVEJ-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 124.44 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.36 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |