C13H13N3O2S — CID 117102978
6-(2-methylanilino)-3-methylsulfanylpyridazine-4-carboxylic acid (PubChem CID 117102978) has the molecular formula C13H13N3O2S and a molecular weight of 275.33 g/mol. Its IUPAC name is 6-(2-methylanilino)-3-methylsulfanylpyridazine-4-carboxylic acid.
| Compound Name | 6-(2-methylanilino)-3-methylsulfanylpyridazine-4-carboxylic acid |
|---|---|
| PubChem CID | 117102978 |
| Molecular Formula | C13H13N3O2S |
| Molecular Weight | 275.33 g/mol |
| Exact Mass | 275.07 |
| IUPAC Name | 6-(2-methylanilino)-3-methylsulfanylpyridazine-4-carboxylic acid |
| SMILES | CSc1nnc(Nc2ccccc2C)cc1C(=O)O |
| InChI | InChI=1S/C13H13N3O2S/c1-8-5-3-4-6-10(8)14-11-7-9(13(17)18)12(19-2)16-15-11/h3-7H,1-2H3,(H,14,15)(H,17,18) |
| InChIKey | VYZOWIPSGPTBRJ-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 75.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.33 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |