C16H17N5O8 — CID 136502460
2-[3-[1-(5-acetyl-4,6-dihydroxy-2-oxopyran-3-yl)ethylideneamino]phenyl]guanidine;nitric acid (PubChem CID 136502460) has the molecular formula C16H17N5O8 and a molecular weight of 407.34 g/mol. Its IUPAC name is 2-[3-[1-(5-acetyl-4,6-dihydroxy-2-oxopyran-3-yl)ethylideneamino]phenyl]guanidine;nitric acid.
| Compound Name | 2-[3-[1-(5-acetyl-4,6-dihydroxy-2-oxopyran-3-yl)ethylideneamino]phenyl]guanidine;nitric acid |
|---|---|
| PubChem CID | 136502460 |
| Molecular Formula | C16H17N5O8 |
| Molecular Weight | 407.34 g/mol |
| Exact Mass | 407.11 |
| IUPAC Name | 2-[3-[1-(5-acetyl-4,6-dihydroxy-2-oxopyran-3-yl)ethylideneamino]phenyl]guanidine;nitric acid |
| SMILES | CC(=O)c1c(O)oc(=O)c(/C(C)=N/c2cccc(N=C(N)N)c2)c1O.O=[N+]([O-])O |
| InChI | InChI=1S/C16H16N4O5.HNO3/c1-7(19-9-4-3-5-10(6-9)20-16(17)18)11-13(22)12(8(2)21)15(24)25-14(11)23;2-1(3)4/h3-6,22,24H,1-2H3,(H4,17,18,20);(H,2,3,4)/b19-7+; |
| InChIKey | HXXTWFYVEADXGX-YRQQTYEQSA-N |
| XLogP | 0.95 |
| TPSA | 227.87 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.34 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|