C14H11NO6 — CID 136610051
5-acetyl-2,4-dihydroxy-6-oxo-N-phenylpyran-3-carboxamide (PubChem CID 136610051) has the molecular formula C14H11NO6 and a molecular weight of 289.24 g/mol. Its IUPAC name is 5-acetyl-2,4-dihydroxy-6-oxo-N-phenylpyran-3-carboxamide.
| Compound Name | 5-acetyl-2,4-dihydroxy-6-oxo-N-phenylpyran-3-carboxamide |
|---|---|
| PubChem CID | 136610051 |
| Molecular Formula | C14H11NO6 |
| Molecular Weight | 289.24 g/mol |
| Exact Mass | 289.06 |
| IUPAC Name | 5-acetyl-2,4-dihydroxy-6-oxo-N-phenylpyran-3-carboxamide |
| SMILES | CC(=O)c1c(O)c(C(=O)Nc2ccccc2)c(O)oc1=O |
| InChI | InChI=1S/C14H11NO6/c1-7(16)9-11(17)10(14(20)21-13(9)19)12(18)15-8-5-3-2-4-6-8/h2-6,17,20H,1H3,(H,15,18) |
| InChIKey | MWUKENWGVAINQN-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 116.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.24 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |