C17H15NO8 — CID 136610070
[4-[(5-acetyl-2,4-dihydroxy-6-oxopyran-3-carbonyl)amino]phenyl] propanoate (PubChem CID 136610070) has the molecular formula C17H15NO8 and a molecular weight of 361.31 g/mol. Its IUPAC name is [4-[(5-acetyl-2,4-dihydroxy-6-oxopyran-3-carbonyl)amino]phenyl] propanoate.
| Compound Name | [4-[(5-acetyl-2,4-dihydroxy-6-oxopyran-3-carbonyl)amino]phenyl] propanoate |
|---|---|
| PubChem CID | 136610070 |
| Molecular Formula | C17H15NO8 |
| Molecular Weight | 361.31 g/mol |
| Exact Mass | 361.08 |
| IUPAC Name | [4-[(5-acetyl-2,4-dihydroxy-6-oxopyran-3-carbonyl)amino]phenyl] propanoate |
| SMILES | CCC(=O)Oc1ccc(NC(=O)c2c(O)oc(=O)c(C(C)=O)c2O)cc1 |
| InChI | InChI=1S/C17H15NO8/c1-3-11(20)25-10-6-4-9(5-7-10)18-15(22)13-14(21)12(8(2)19)16(23)26-17(13)24/h4-7,21,24H,3H2,1-2H3,(H,18,22) |
| InChIKey | YSBALEUEVOTYCW-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 143.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.31 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|