C14H11NO7 — CID 136610060
5-acetyl-2,4-dihydroxy-N-(4-hydroxyphenyl)-6-oxopyran-3-carboxamide (PubChem CID 136610060) has the molecular formula C14H11NO7 and a molecular weight of 305.24 g/mol. Its IUPAC name is 5-acetyl-2,4-dihydroxy-N-(4-hydroxyphenyl)-6-oxopyran-3-carboxamide.
| Compound Name | 5-acetyl-2,4-dihydroxy-N-(4-hydroxyphenyl)-6-oxopyran-3-carboxamide |
|---|---|
| PubChem CID | 136610060 |
| Molecular Formula | C14H11NO7 |
| Molecular Weight | 305.24 g/mol |
| Exact Mass | 305.05 |
| IUPAC Name | 5-acetyl-2,4-dihydroxy-N-(4-hydroxyphenyl)-6-oxopyran-3-carboxamide |
| SMILES | CC(=O)c1c(O)c(C(=O)Nc2ccc(O)cc2)c(O)oc1=O |
| InChI | InChI=1S/C14H11NO7/c1-6(16)9-11(18)10(14(21)22-13(9)20)12(19)15-7-2-4-8(17)5-3-7/h2-5,17-18,21H,1H3,(H,15,19) |
| InChIKey | VWRALUHYCVNGRJ-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 137.07 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.24 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|