C19H14N2O4 — CID 54696259
4-hydroxy-5-methyl-2-oxo-N-phenylpyrano[3,2-b]indole-3-carboxamide (PubChem CID 54696259) has the molecular formula C19H14N2O4 and a molecular weight of 334.33 g/mol. Its IUPAC name is 4-hydroxy-5-methyl-2-oxo-N-phenylpyrano[3,2-b]indole-3-carboxamide.
| Compound Name | 4-hydroxy-5-methyl-2-oxo-N-phenylpyrano[3,2-b]indole-3-carboxamide |
|---|---|
| PubChem CID | 54696259 |
| Molecular Formula | C19H14N2O4 |
| Molecular Weight | 334.33 g/mol |
| Exact Mass | 334.10 |
| IUPAC Name | 4-hydroxy-5-methyl-2-oxo-N-phenylpyrano[3,2-b]indole-3-carboxamide |
| SMILES | Cn1c2ccccc2c2oc(=O)c(C(=O)Nc3ccccc3)c(O)c21 |
| InChI | InChI=1S/C19H14N2O4/c1-21-13-10-6-5-9-12(13)17-15(21)16(22)14(19(24)25-17)18(23)20-11-7-3-2-4-8-11/h2-10,22H,1H3,(H,20,23) |
| InChIKey | UMABCTISJXVHJY-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 84.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.33 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |