C32H26N2O3 — CID 10576901
2,5-bis(4-methylphenyl)-3-N,4-N-diphenylfuran-3,4-dicarboxamide (PubChem CID 10576901) has the molecular formula C32H26N2O3 and a molecular weight of 486.57 g/mol. Its IUPAC name is 2,5-bis(4-methylphenyl)-3-N,4-N-diphenylfuran-3,4-dicarboxamide.
| Compound Name | 2,5-bis(4-methylphenyl)-3-N,4-N-diphenylfuran-3,4-dicarboxamide |
|---|---|
| PubChem CID | 10576901 |
| Molecular Formula | C32H26N2O3 |
| Molecular Weight | 486.57 g/mol |
| Exact Mass | 486.19 |
| IUPAC Name | 2,5-bis(4-methylphenyl)-3-N,4-N-diphenylfuran-3,4-dicarboxamide |
| SMILES | Cc1ccc(-c2oc(-c3ccc(C)cc3)c(C(=O)Nc3ccccc3)c2C(=O)Nc2ccccc2)cc1 |
| InChI | InChI=1S/C32H26N2O3/c1-21-13-17-23(18-14-21)29-27(31(35)33-25-9-5-3-6-10-25)28(32(36)34-26-11-7-4-8-12-26)30(37-29)24-19-15-22(2)16-20-24/h3-20H,1-2H3,(H,33,35)(H,34,36) |
| InChIKey | QBOAGSOIZWXQHA-UHFFFAOYSA-N |
| XLogP | 7.74 |
| TPSA | 71.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.57 |
| LogP ≤ 5 | 7.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |