C17H11Cl2NO3 — CID 146020943
3-[N-(3,4-dichlorophenyl)-C-methylcarbonimidoyl]-4-hydroxychromen-2-one (PubChem CID 146020943) has the molecular formula C17H11Cl2NO3 and a molecular weight of 348.19 g/mol. Its IUPAC name is 3-[N-(3,4-dichlorophenyl)-C-methylcarbonimidoyl]-4-hydroxychromen-2-one.
| Compound Name | 3-[N-(3,4-dichlorophenyl)-C-methylcarbonimidoyl]-4-hydroxychromen-2-one |
|---|---|
| PubChem CID | 146020943 |
| Molecular Formula | C17H11Cl2NO3 |
| Molecular Weight | 348.19 g/mol |
| Exact Mass | 347.01 |
| IUPAC Name | 3-[N-(3,4-dichlorophenyl)-C-methylcarbonimidoyl]-4-hydroxychromen-2-one |
| SMILES | C/C(=N\c1ccc(Cl)c(Cl)c1)c1c(O)c2ccccc2oc1=O |
| InChI | InChI=1S/C17H11Cl2NO3/c1-9(20-10-6-7-12(18)13(19)8-10)15-16(21)11-4-2-3-5-14(11)23-17(15)22/h2-8,21H,1H3/b20-9+ |
| InChIKey | JMDIIBPEPDFSRD-AWQFTUOYSA-N |
| XLogP | 4.95 |
| TPSA | 62.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.19 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|