C18H18N2O6 — CID 136502482
3-[1-(5-acetyl-4,6-dihydroxy-2-oxopyran-3-yl)ethylideneamino]-N-ethylbenzamide (PubChem CID 136502482) has the molecular formula C18H18N2O6 and a molecular weight of 358.35 g/mol. Its IUPAC name is 3-[1-(5-acetyl-4,6-dihydroxy-2-oxopyran-3-yl)ethylideneamino]-N-ethylbenzamide.
| Compound Name | 3-[1-(5-acetyl-4,6-dihydroxy-2-oxopyran-3-yl)ethylideneamino]-N-ethylbenzamide |
|---|---|
| PubChem CID | 136502482 |
| Molecular Formula | C18H18N2O6 |
| Molecular Weight | 358.35 g/mol |
| Exact Mass | 358.12 |
| IUPAC Name | 3-[1-(5-acetyl-4,6-dihydroxy-2-oxopyran-3-yl)ethylideneamino]-N-ethylbenzamide |
| SMILES | CCNC(=O)c1cccc(/N=C(\C)c2c(O)c(C(C)=O)c(O)oc2=O)c1 |
| InChI | InChI=1S/C18H18N2O6/c1-4-19-16(23)11-6-5-7-12(8-11)20-9(2)13-15(22)14(10(3)21)18(25)26-17(13)24/h5-8,22,25H,4H2,1-3H3,(H,19,23)/b20-9+ |
| InChIKey | RNXBLONQYWONOC-AWQFTUOYSA-N |
| XLogP | 2.14 |
| TPSA | 129.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.35 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|