C14H11NO9 — CID 136610018
5-acetyl-2,4-dihydroxy-6-oxo-N-(3,4,5-trihydroxyphenyl)pyran-3-carboxamide (PubChem CID 136610018) has the molecular formula C14H11NO9 and a molecular weight of 337.24 g/mol. Its IUPAC name is 5-acetyl-2,4-dihydroxy-6-oxo-N-(3,4,5-trihydroxyphenyl)pyran-3-carboxamide.
| Compound Name | 5-acetyl-2,4-dihydroxy-6-oxo-N-(3,4,5-trihydroxyphenyl)pyran-3-carboxamide |
|---|---|
| PubChem CID | 136610018 |
| Molecular Formula | C14H11NO9 |
| Molecular Weight | 337.24 g/mol |
| Exact Mass | 337.04 |
| IUPAC Name | 5-acetyl-2,4-dihydroxy-6-oxo-N-(3,4,5-trihydroxyphenyl)pyran-3-carboxamide |
| SMILES | CC(=O)c1c(O)c(C(=O)Nc2cc(O)c(O)c(O)c2)c(O)oc1=O |
| InChI | InChI=1S/C14H11NO9/c1-4(16)8-11(20)9(14(23)24-13(8)22)12(21)15-5-2-6(17)10(19)7(18)3-5/h2-3,17-20,23H,1H3,(H,15,21) |
| InChIKey | QVDPFYMGPLOYSZ-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 177.53 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.24 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|