C13H17N3O5 — CID 108871726
4-acetyl-N-(3,4,5-trihydroxyphenyl)piperazine-1-carboxamide (PubChem CID 108871726) has the molecular formula C13H17N3O5 and a molecular weight of 295.30 g/mol. Its IUPAC name is 4-acetyl-N-(3,4,5-trihydroxyphenyl)piperazine-1-carboxamide.
| Compound Name | 4-acetyl-N-(3,4,5-trihydroxyphenyl)piperazine-1-carboxamide |
|---|---|
| PubChem CID | 108871726 |
| Molecular Formula | C13H17N3O5 |
| Molecular Weight | 295.30 g/mol |
| Exact Mass | 295.12 |
| IUPAC Name | 4-acetyl-N-(3,4,5-trihydroxyphenyl)piperazine-1-carboxamide |
| SMILES | CC(=O)N1CCN(C(=O)Nc2cc(O)c(O)c(O)c2)CC1 |
| InChI | InChI=1S/C13H17N3O5/c1-8(17)15-2-4-16(5-3-15)13(21)14-9-6-10(18)12(20)11(19)7-9/h6-7,18-20H,2-5H2,1H3,(H,14,21) |
| InChIKey | PVNYEVJKIVPCSS-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 113.34 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.30 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|