C8H11N3O3S — CID 156788571
2-(diaminomethylideneamino)-4-methylbenzenesulfonic acid (PubChem CID 156788571) has the molecular formula C8H11N3O3S and a molecular weight of 229.26 g/mol. Its IUPAC name is 2-(diaminomethylideneamino)-4-methylbenzenesulfonic acid.
| Compound Name | 2-(diaminomethylideneamino)-4-methylbenzenesulfonic acid |
|---|---|
| PubChem CID | 156788571 |
| Molecular Formula | C8H11N3O3S |
| Molecular Weight | 229.26 g/mol |
| Exact Mass | 229.05 |
| IUPAC Name | 2-(diaminomethylideneamino)-4-methylbenzenesulfonic acid |
| SMILES | Cc1ccc(S(=O)(=O)O)c(N=C(N)N)c1 |
| InChI | InChI=1S/C8H11N3O3S/c1-5-2-3-7(15(12,13)14)6(4-5)11-8(9)10/h2-4H,1H3,(H4,9,10,11)(H,12,13,14) |
| InChIKey | GMYYXPMXCOAZAN-UHFFFAOYSA-N |
| XLogP | 0.15 |
| TPSA | 118.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.26 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|