C9H13N3O2S — CID 46256438
2-(2,4-dimethylphenyl)sulfonylguanidine (PubChem CID 46256438) has the molecular formula C9H13N3O2S and a molecular weight of 227.29 g/mol. Its IUPAC name is 2-(2,4-dimethylphenyl)sulfonylguanidine.
| Compound Name | 2-(2,4-dimethylphenyl)sulfonylguanidine |
|---|---|
| PubChem CID | 46256438 |
| Molecular Formula | C9H13N3O2S |
| Molecular Weight | 227.29 g/mol |
| Exact Mass | 227.07 |
| IUPAC Name | 2-(2,4-dimethylphenyl)sulfonylguanidine |
| SMILES | Cc1ccc(S(=O)(=O)N=C(N)N)c(C)c1 |
| InChI | InChI=1S/C9H13N3O2S/c1-6-3-4-8(7(2)5-6)15(13,14)12-9(10)11/h3-5H,1-2H3,(H4,10,11,12) |
| InChIKey | PDBLMAMHNVRIHL-UHFFFAOYSA-N |
| XLogP | 0.27 |
| TPSA | 98.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.29 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|