C9H10I2O2S — CID 21439611
1-(diiodomethylsulfonyl)-2,4-dimethylbenzene (PubChem CID 21439611) has the molecular formula C9H10I2O2S and a molecular weight of 436.05 g/mol. Its IUPAC name is 1-(diiodomethylsulfonyl)-2,4-dimethylbenzene.
| Compound Name | 1-(diiodomethylsulfonyl)-2,4-dimethylbenzene |
|---|---|
| PubChem CID | 21439611 |
| Molecular Formula | C9H10I2O2S |
| Molecular Weight | 436.05 g/mol |
| Exact Mass | 435.85 |
| IUPAC Name | 1-(diiodomethylsulfonyl)-2,4-dimethylbenzene |
| SMILES | Cc1ccc(S(=O)(=O)C(I)I)c(C)c1 |
| InChI | InChI=1S/C9H10I2O2S/c1-6-3-4-8(7(2)5-6)14(12,13)9(10)11/h3-5,9H,1-2H3 |
| InChIKey | HVCKRTWXCXDXEJ-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.05 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|