C10H14O2S2 — CID 117036897
2-(2,4-dimethylphenyl)sulfonylethanethiol (PubChem CID 117036897) has the molecular formula C10H14O2S2 and a molecular weight of 230.35 g/mol. Its IUPAC name is 2-(2,4-dimethylphenyl)sulfonylethanethiol.
| Compound Name | 2-(2,4-dimethylphenyl)sulfonylethanethiol |
|---|---|
| PubChem CID | 117036897 |
| Molecular Formula | C10H14O2S2 |
| Molecular Weight | 230.35 g/mol |
| Exact Mass | 230.04 |
| IUPAC Name | 2-(2,4-dimethylphenyl)sulfonylethanethiol |
| SMILES | Cc1ccc(S(=O)(=O)CCS)c(C)c1 |
| InChI | InChI=1S/C10H14O2S2/c1-8-3-4-10(9(2)7-8)14(11,12)6-5-13/h3-4,7,13H,5-6H2,1-2H3 |
| InChIKey | IXQVTAQVMSIVMY-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 34.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.35 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|