C24H27O9PS3 — CID 158936885
bis[(2,4-dimethylphenyl)sulfonyloxy]phosphanyl 2,4-dimethylbenzenesulfonate (PubChem CID 158936885) has the molecular formula C24H27O9PS3 and a molecular weight of 586.65 g/mol. Its IUPAC name is bis[(2,4-dimethylphenyl)sulfonyloxy]phosphanyl 2,4-dimethylbenzenesulfonate.
| Compound Name | bis[(2,4-dimethylphenyl)sulfonyloxy]phosphanyl 2,4-dimethylbenzenesulfonate |
|---|---|
| PubChem CID | 158936885 |
| Molecular Formula | C24H27O9PS3 |
| Molecular Weight | 586.65 g/mol |
| Exact Mass | 586.06 |
| IUPAC Name | bis[(2,4-dimethylphenyl)sulfonyloxy]phosphanyl 2,4-dimethylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OP(OS(=O)(=O)c2ccc(C)cc2C)OS(=O)(=O)c2ccc(C)cc2C)c(C)c1 |
| InChI | InChI=1S/C24H27O9PS3/c1-16-7-10-22(19(4)13-16)35(25,26)31-34(32-36(27,28)23-11-8-17(2)14-20(23)5)33-37(29,30)24-12-9-18(3)15-21(24)6/h7-15H,1-6H3 |
| InChIKey | JJTKWKAJCHCSCE-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 130.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.65 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|