C10H15F3S — CID 143617729
(2,4-dimethylphenyl)-trifluoro-λ4-sulfane;ethane (PubChem CID 143617729) has the molecular formula C10H15F3S and a molecular weight of 224.29 g/mol. Its IUPAC name is (2,4-dimethylphenyl)-trifluoro-λ4-sulfane;ethane.
| Compound Name | (2,4-dimethylphenyl)-trifluoro-λ4-sulfane;ethane |
|---|---|
| PubChem CID | 143617729 |
| Molecular Formula | C10H15F3S |
| Molecular Weight | 224.29 g/mol |
| Exact Mass | 224.08 |
| IUPAC Name | (2,4-dimethylphenyl)-trifluoro-λ4-sulfane;ethane |
| SMILES | CC.Cc1ccc(S(F)(F)F)c(C)c1 |
| InChI | InChI=1S/C8H9F3S.C2H6/c1-6-3-4-8(7(2)5-6)12(9,10)11;1-2/h3-5H,1-2H3;1-2H3 |
| InChIKey | LTXSRXIQZCOJQP-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.29 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |