C11H13NO4S — CID 87696669
[(2S)-4-oxoazetidin-2-yl] 2,4-dimethylbenzenesulfonate (PubChem CID 87696669) has the molecular formula C11H13NO4S and a molecular weight of 255.29 g/mol. Its IUPAC name is [(2S)-4-oxoazetidin-2-yl] 2,4-dimethylbenzenesulfonate.
| Compound Name | [(2S)-4-oxoazetidin-2-yl] 2,4-dimethylbenzenesulfonate |
|---|---|
| PubChem CID | 87696669 |
| Molecular Formula | C11H13NO4S |
| Molecular Weight | 255.29 g/mol |
| Exact Mass | 255.06 |
| IUPAC Name | [(2S)-4-oxoazetidin-2-yl] 2,4-dimethylbenzenesulfonate |
| SMILES | CC1=CC(=C(C=C1)S(=O)(=O)O[C@H]2CC(=O)N2)C |
| InChI | InChI=1S/C11H13NO4S/c1-7-3-4-9(8(2)5-7)17(14,15)16-11-6-10(13)12-11/h3-5,11H,6H2,1-2H3,(H,12,13)/t11-/m0/s1 |
| InChIKey | UYRVWINWBUYBNQ-NSHDSACASA-N |
| XLogP | 1.10 |
| TPSA | 80.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | 400 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.29 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|