C24H23FO4S — CID 87699393
[7-(2,6-dimethylphenyl)-5-fluoro-2,3-dihydro-1-benzofuran-2-yl] 2,4-dimethylbenzenesulfonate (PubChem CID 87699393) has the molecular formula C24H23FO4S and a molecular weight of 426.51 g/mol. Its IUPAC name is [7-(2,6-dimethylphenyl)-5-fluoro-2,3-dihydro-1-benzofuran-2-yl] 2,4-dimethylbenzenesulfonate.
| Compound Name | [7-(2,6-dimethylphenyl)-5-fluoro-2,3-dihydro-1-benzofuran-2-yl] 2,4-dimethylbenzenesulfonate |
|---|---|
| PubChem CID | 87699393 |
| Molecular Formula | C24H23FO4S |
| Molecular Weight | 426.51 g/mol |
| Exact Mass | 426.13 |
| IUPAC Name | [7-(2,6-dimethylphenyl)-5-fluoro-2,3-dihydro-1-benzofuran-2-yl] 2,4-dimethylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OC2Cc3cc(F)cc(-c4c(C)cccc4C)c3O2)c(C)c1 |
| InChI | InChI=1S/C24H23FO4S/c1-14-8-9-21(17(4)10-14)30(26,27)29-22-12-18-11-19(25)13-20(24(18)28-22)23-15(2)6-5-7-16(23)3/h5-11,13,22H,12H2,1-4H3 |
| InChIKey | KAVQXEGPXGFMFB-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.51 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|