C24H24O4S — CID 90736389
methyl 2-[7-(2,3-dimethylphenyl)-2,3-dihydro-1-benzofuran-2-yl]-4-methylbenzenesulfonate (PubChem CID 90736389) has the molecular formula C24H24O4S and a molecular weight of 408.52 g/mol. Its IUPAC name is methyl 2-[7-(2,3-dimethylphenyl)-2,3-dihydro-1-benzofuran-2-yl]-4-methylbenzenesulfonate.
| Compound Name | methyl 2-[7-(2,3-dimethylphenyl)-2,3-dihydro-1-benzofuran-2-yl]-4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 90736389 |
| Molecular Formula | C24H24O4S |
| Molecular Weight | 408.52 g/mol |
| Exact Mass | 408.14 |
| IUPAC Name | methyl 2-[7-(2,3-dimethylphenyl)-2,3-dihydro-1-benzofuran-2-yl]-4-methylbenzenesulfonate |
| SMILES | COS(=O)(=O)c1ccc(C)cc1C1Cc2cccc(-c3cccc(C)c3C)c2O1 |
| InChI | InChI=1S/C24H24O4S/c1-15-11-12-23(29(25,26)27-4)21(13-15)22-14-18-8-6-10-20(24(18)28-22)19-9-5-7-16(2)17(19)3/h5-13,22H,14H2,1-4H3 |
| InChIKey | QVCQBSNMJXVRLI-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.52 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|