C22H18Cl2O4S — CID 91155411
methyl 2-[5-chloro-7-(2-chlorophenyl)-2,3-dihydro-1-benzofuran-2-yl]-4-methylbenzenesulfonate (PubChem CID 91155411) has the molecular formula C22H18Cl2O4S and a molecular weight of 449.36 g/mol. Its IUPAC name is methyl 2-[5-chloro-7-(2-chlorophenyl)-2,3-dihydro-1-benzofuran-2-yl]-4-methylbenzenesulfonate.
| Compound Name | methyl 2-[5-chloro-7-(2-chlorophenyl)-2,3-dihydro-1-benzofuran-2-yl]-4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 91155411 |
| Molecular Formula | C22H18Cl2O4S |
| Molecular Weight | 449.36 g/mol |
| Exact Mass | 448.03 |
| IUPAC Name | methyl 2-[5-chloro-7-(2-chlorophenyl)-2,3-dihydro-1-benzofuran-2-yl]-4-methylbenzenesulfonate |
| SMILES | COS(=O)(=O)c1ccc(C)cc1C1Cc2cc(Cl)cc(-c3ccccc3Cl)c2O1 |
| InChI | InChI=1S/C22H18Cl2O4S/c1-13-7-8-21(29(25,26)27-2)18(9-13)20-11-14-10-15(23)12-17(22(14)28-20)16-5-3-4-6-19(16)24/h3-10,12,20H,11H2,1-2H3 |
| InChIKey | BTILSWRNRSUYPM-UHFFFAOYSA-N |
| XLogP | 5.98 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.36 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|