C23H21FO5S — CID 90772949
methyl 2-[5-fluoro-7-(2-methoxyphenyl)-2,3-dihydro-1-benzofuran-2-yl]-4-methylbenzenesulfonate (PubChem CID 90772949) has the molecular formula C23H21FO5S and a molecular weight of 428.48 g/mol. Its IUPAC name is methyl 2-[5-fluoro-7-(2-methoxyphenyl)-2,3-dihydro-1-benzofuran-2-yl]-4-methylbenzenesulfonate.
| Compound Name | methyl 2-[5-fluoro-7-(2-methoxyphenyl)-2,3-dihydro-1-benzofuran-2-yl]-4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 90772949 |
| Molecular Formula | C23H21FO5S |
| Molecular Weight | 428.48 g/mol |
| Exact Mass | 428.11 |
| IUPAC Name | methyl 2-[5-fluoro-7-(2-methoxyphenyl)-2,3-dihydro-1-benzofuran-2-yl]-4-methylbenzenesulfonate |
| SMILES | COc1ccccc1-c1cc(F)cc2c1OC(c1cc(C)ccc1S(=O)(=O)OC)C2 |
| InChI | InChI=1S/C23H21FO5S/c1-14-8-9-22(30(25,26)28-3)19(10-14)21-12-15-11-16(24)13-18(23(15)29-21)17-6-4-5-7-20(17)27-2/h4-11,13,21H,12H2,1-3H3 |
| InChIKey | XBIRBXXUVAKHQY-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.48 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|