C23H19F3O4S — CID 91262951
methyl 4-methyl-2-[7-[2-(trifluoromethyl)phenyl]-2,3-dihydro-1-benzofuran-2-yl]benzenesulfonate (PubChem CID 91262951) has the molecular formula C23H19F3O4S and a molecular weight of 448.46 g/mol. Its IUPAC name is methyl 4-methyl-2-[7-[2-(trifluoromethyl)phenyl]-2,3-dihydro-1-benzofuran-2-yl]benzenesulfonate.
| Compound Name | methyl 4-methyl-2-[7-[2-(trifluoromethyl)phenyl]-2,3-dihydro-1-benzofuran-2-yl]benzenesulfonate |
|---|---|
| PubChem CID | 91262951 |
| Molecular Formula | C23H19F3O4S |
| Molecular Weight | 448.46 g/mol |
| Exact Mass | 448.10 |
| IUPAC Name | methyl 4-methyl-2-[7-[2-(trifluoromethyl)phenyl]-2,3-dihydro-1-benzofuran-2-yl]benzenesulfonate |
| SMILES | COS(=O)(=O)c1ccc(C)cc1C1Cc2cccc(-c3ccccc3C(F)(F)F)c2O1 |
| InChI | InChI=1S/C23H19F3O4S/c1-14-10-11-21(31(27,28)29-2)18(12-14)20-13-15-6-5-8-17(22(15)30-20)16-7-3-4-9-19(16)23(24,25)26/h3-12,20H,13H2,1-2H3 |
| InChIKey | OTQGTTXCDUDXPH-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.46 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|