C25H26O6S — CID 90904517
methyl 2-[7-(2,3-dimethoxyphenyl)-5-methyl-2,3-dihydro-1-benzofuran-2-yl]-4-methylbenzenesulfonate (PubChem CID 90904517) has the molecular formula C25H26O6S and a molecular weight of 454.54 g/mol. Its IUPAC name is methyl 2-[7-(2,3-dimethoxyphenyl)-5-methyl-2,3-dihydro-1-benzofuran-2-yl]-4-methylbenzenesulfonate.
| Compound Name | methyl 2-[7-(2,3-dimethoxyphenyl)-5-methyl-2,3-dihydro-1-benzofuran-2-yl]-4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 90904517 |
| Molecular Formula | C25H26O6S |
| Molecular Weight | 454.54 g/mol |
| Exact Mass | 454.15 |
| IUPAC Name | methyl 2-[7-(2,3-dimethoxyphenyl)-5-methyl-2,3-dihydro-1-benzofuran-2-yl]-4-methylbenzenesulfonate |
| SMILES | COc1cccc(-c2cc(C)cc3c2OC(c2cc(C)ccc2S(=O)(=O)OC)C3)c1OC |
| InChI | InChI=1S/C25H26O6S/c1-15-9-10-23(32(26,27)30-5)20(12-15)22-14-17-11-16(2)13-19(24(17)31-22)18-7-6-8-21(28-3)25(18)29-4/h6-13,22H,14H2,1-5H3 |
| InChIKey | DAGSMUQRCPHJIR-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.54 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|