C12H14O5S — CID 175376418
[(2R)-5-oxooxolan-2-yl] 2,4-dimethylbenzenesulfonate (PubChem CID 175376418) has the molecular formula C12H14O5S and a molecular weight of 270.31 g/mol. Its IUPAC name is [(2R)-5-oxooxolan-2-yl] 2,4-dimethylbenzenesulfonate.
| Compound Name | [(2R)-5-oxooxolan-2-yl] 2,4-dimethylbenzenesulfonate |
|---|---|
| PubChem CID | 175376418 |
| Molecular Formula | C12H14O5S |
| Molecular Weight | 270.31 g/mol |
| Exact Mass | 270.06 |
| IUPAC Name | [(2R)-5-oxooxolan-2-yl] 2,4-dimethylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)O[C@@H]2CCC(=O)O2)c(C)c1 |
| InChI | InChI=1S/C12H14O5S/c1-8-3-4-10(9(2)7-8)18(14,15)17-12-6-5-11(13)16-12/h3-4,7,12H,5-6H2,1-2H3/t12-/m1/s1 |
| InChIKey | QAMMOOMECRMCIG-GFCCVEGCSA-N |
| XLogP | 1.67 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.31 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|