C17H19BrN2O4S — CID 175152836
[4-(4-bromo-2-pyridinyl)morpholin-2-yl] 2,4-dimethylbenzenesulfonate (PubChem CID 175152836) has the molecular formula C17H19BrN2O4S and a molecular weight of 427.32 g/mol. Its IUPAC name is [4-(4-bromo-2-pyridinyl)morpholin-2-yl] 2,4-dimethylbenzenesulfonate.
| Compound Name | [4-(4-bromo-2-pyridinyl)morpholin-2-yl] 2,4-dimethylbenzenesulfonate |
|---|---|
| PubChem CID | 175152836 |
| Molecular Formula | C17H19BrN2O4S |
| Molecular Weight | 427.32 g/mol |
| Exact Mass | 426.02 |
| IUPAC Name | [4-(4-bromo-2-pyridinyl)morpholin-2-yl] 2,4-dimethylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OC2CN(c3cc(Br)ccn3)CCO2)c(C)c1 |
| InChI | InChI=1S/C17H19BrN2O4S/c1-12-3-4-15(13(2)9-12)25(21,22)24-17-11-20(7-8-23-17)16-10-14(18)5-6-19-16/h3-6,9-10,17H,7-8,11H2,1-2H3 |
| InChIKey | IAFIELBEPDMWRT-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 68.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.32 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|