C11H13NO2S — CID 28753115
3-(2,4-dimethylphenyl)sulfonylpropanenitrile (PubChem CID 28753115) has the molecular formula C11H13NO2S and a molecular weight of 223.30 g/mol. Its IUPAC name is 3-(2,4-dimethylphenyl)sulfonylpropanenitrile.
| Compound Name | 3-(2,4-dimethylphenyl)sulfonylpropanenitrile |
|---|---|
| PubChem CID | 28753115 |
| Molecular Formula | C11H13NO2S |
| Molecular Weight | 223.30 g/mol |
| Exact Mass | 223.07 |
| IUPAC Name | 3-(2,4-dimethylphenyl)sulfonylpropanenitrile |
| SMILES | Cc1ccc(S(=O)(=O)CCC#N)c(C)c1 |
| InChI | InChI=1S/C11H13NO2S/c1-9-4-5-11(10(2)8-9)15(13,14)7-3-6-12/h4-5,8H,3,7H2,1-2H3 |
| InChIKey | URJYXTWKHWJWCI-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 57.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.30 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |