C12H15NO3S — CID 28753127
3-(4-methoxy-2,5-dimethylphenyl)sulfonylpropanenitrile (PubChem CID 28753127) has the molecular formula C12H15NO3S and a molecular weight of 253.32 g/mol. Its IUPAC name is 3-(4-methoxy-2,5-dimethylphenyl)sulfonylpropanenitrile.
| Compound Name | 3-(4-methoxy-2,5-dimethylphenyl)sulfonylpropanenitrile |
|---|---|
| PubChem CID | 28753127 |
| Molecular Formula | C12H15NO3S |
| Molecular Weight | 253.32 g/mol |
| Exact Mass | 253.08 |
| IUPAC Name | 3-(4-methoxy-2,5-dimethylphenyl)sulfonylpropanenitrile |
| SMILES | COc1cc(C)c(S(=O)(=O)CCC#N)cc1C |
| InChI | InChI=1S/C12H15NO3S/c1-9-8-12(10(2)7-11(9)16-3)17(14,15)6-4-5-13/h7-8H,4,6H2,1-3H3 |
| InChIKey | ATQSYWLZIJFVMW-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 67.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.32 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |