C10H11NO3S — CID 117036989
(4-methoxy-2,5-dimethylphenyl)sulfonylformonitrile (PubChem CID 117036989) has the molecular formula C10H11NO3S and a molecular weight of 225.27 g/mol. Its IUPAC name is (4-methoxy-2,5-dimethylphenyl)sulfonylformonitrile.
| Compound Name | (4-methoxy-2,5-dimethylphenyl)sulfonylformonitrile |
|---|---|
| PubChem CID | 117036989 |
| Molecular Formula | C10H11NO3S |
| Molecular Weight | 225.27 g/mol |
| Exact Mass | 225.05 |
| IUPAC Name | (4-methoxy-2,5-dimethylphenyl)sulfonylformonitrile |
| SMILES | COc1cc(C)c(S(=O)(=O)C#N)cc1C |
| InChI | InChI=1S/C10H11NO3S/c1-7-5-10(15(12,13)6-11)8(2)4-9(7)14-3/h4-5H,1-3H3 |
| InChIKey | VGSRDHKUDANMGS-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 67.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.27 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'sulfonyl_cyanide', 'substructure': 'N/A'} |
|---|