C12H15NO4S — CID 116855325
3-(2,5-dimethoxy-4-methylphenyl)sulfonylpropanenitrile (PubChem CID 116855325) has the molecular formula C12H15NO4S and a molecular weight of 269.32 g/mol. Its IUPAC name is 3-(2,5-dimethoxy-4-methylphenyl)sulfonylpropanenitrile.
| Compound Name | 3-(2,5-dimethoxy-4-methylphenyl)sulfonylpropanenitrile |
|---|---|
| PubChem CID | 116855325 |
| Molecular Formula | C12H15NO4S |
| Molecular Weight | 269.32 g/mol |
| Exact Mass | 269.07 |
| IUPAC Name | 3-(2,5-dimethoxy-4-methylphenyl)sulfonylpropanenitrile |
| SMILES | COc1cc(S(=O)(=O)CCC#N)c(OC)cc1C |
| InChI | InChI=1S/C12H15NO4S/c1-9-7-11(17-3)12(8-10(9)16-2)18(14,15)6-4-5-13/h7-8H,4,6H2,1-3H3 |
| InChIKey | CRWPAVQFVHDDPX-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 76.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.32 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |