C10H14O3S2 — CID 117036874
(2-methoxy-4,5-dimethylphenyl)sulfonylmethanethiol (PubChem CID 117036874) has the molecular formula C10H14O3S2 and a molecular weight of 246.35 g/mol. Its IUPAC name is (2-methoxy-4,5-dimethylphenyl)sulfonylmethanethiol.
| Compound Name | (2-methoxy-4,5-dimethylphenyl)sulfonylmethanethiol |
|---|---|
| PubChem CID | 117036874 |
| Molecular Formula | C10H14O3S2 |
| Molecular Weight | 246.35 g/mol |
| Exact Mass | 246.04 |
| IUPAC Name | (2-methoxy-4,5-dimethylphenyl)sulfonylmethanethiol |
| SMILES | COc1cc(C)c(C)cc1S(=O)(=O)CS |
| InChI | InChI=1S/C10H14O3S2/c1-7-4-9(13-3)10(5-8(7)2)15(11,12)6-14/h4-5,14H,6H2,1-3H3 |
| InChIKey | CDBQDDSALJUNRX-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 43.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.35 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|