C9H14N2O3S — CID 82081811
2-methoxy-4,5-dimethylbenzenesulfonohydrazide (PubChem CID 82081811) has the molecular formula C9H14N2O3S and a molecular weight of 230.29 g/mol. Its IUPAC name is 2-methoxy-4,5-dimethylbenzenesulfonohydrazide.
| Compound Name | 2-methoxy-4,5-dimethylbenzenesulfonohydrazide |
|---|---|
| PubChem CID | 82081811 |
| Molecular Formula | C9H14N2O3S |
| Molecular Weight | 230.29 g/mol |
| Exact Mass | 230.07 |
| IUPAC Name | 2-methoxy-4,5-dimethylbenzenesulfonohydrazide |
| SMILES | COc1cc(C)c(C)cc1S(=O)(=O)NN |
| InChI | InChI=1S/C9H14N2O3S/c1-6-4-8(14-3)9(5-7(6)2)15(12,13)11-10/h4-5,11H,10H2,1-3H3 |
| InChIKey | XTIAMVBYOWTZLU-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.29 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|