C13H16N2O3S — CID 82181488
2-(2-cyanoethylsulfonyl)-N-(2,5-dimethylphenyl)acetamide (PubChem CID 82181488) has the molecular formula C13H16N2O3S and a molecular weight of 280.35 g/mol. Its IUPAC name is 2-(2-cyanoethylsulfonyl)-N-(2,5-dimethylphenyl)acetamide.
| Compound Name | 2-(2-cyanoethylsulfonyl)-N-(2,5-dimethylphenyl)acetamide |
|---|---|
| PubChem CID | 82181488 |
| Molecular Formula | C13H16N2O3S |
| Molecular Weight | 280.35 g/mol |
| Exact Mass | 280.09 |
| IUPAC Name | 2-(2-cyanoethylsulfonyl)-N-(2,5-dimethylphenyl)acetamide |
| SMILES | Cc1ccc(C)c(NC(=O)CS(=O)(=O)CCC#N)c1 |
| InChI | InChI=1S/C13H16N2O3S/c1-10-4-5-11(2)12(8-10)15-13(16)9-19(17,18)7-3-6-14/h4-5,8H,3,7,9H2,1-2H3,(H,15,16) |
| InChIKey | ISDOHHHSQXCOQQ-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 87.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.35 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |