C15H25NO2S — CID 64639433
2-(2,4-dimethylphenyl)sulfonyl-N-ethylpentan-3-amine (PubChem CID 64639433) has the molecular formula C15H25NO2S and a molecular weight of 283.44 g/mol. Its IUPAC name is 2-(2,4-dimethylphenyl)sulfonyl-N-ethylpentan-3-amine.
| Compound Name | 2-(2,4-dimethylphenyl)sulfonyl-N-ethylpentan-3-amine |
|---|---|
| PubChem CID | 64639433 |
| Molecular Formula | C15H25NO2S |
| Molecular Weight | 283.44 g/mol |
| Exact Mass | 283.16 |
| IUPAC Name | 2-(2,4-dimethylphenyl)sulfonyl-N-ethylpentan-3-amine |
| SMILES | CCNC(CC)C(C)S(=O)(=O)c1ccc(C)cc1C |
| InChI | InChI=1S/C15H25NO2S/c1-6-14(16-7-2)13(5)19(17,18)15-9-8-11(3)10-12(15)4/h8-10,13-14,16H,6-7H2,1-5H3 |
| InChIKey | LHMFFOAUUUWLNH-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.44 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |