C13H20O3S — CID 117037707
2-(2,4-dimethylphenyl)sulfonyl-3-methylbutan-1-ol (PubChem CID 117037707) has the molecular formula C13H20O3S and a molecular weight of 256.37 g/mol. Its IUPAC name is 2-(2,4-dimethylphenyl)sulfonyl-3-methylbutan-1-ol.
| Compound Name | 2-(2,4-dimethylphenyl)sulfonyl-3-methylbutan-1-ol |
|---|---|
| PubChem CID | 117037707 |
| Molecular Formula | C13H20O3S |
| Molecular Weight | 256.37 g/mol |
| Exact Mass | 256.11 |
| IUPAC Name | 2-(2,4-dimethylphenyl)sulfonyl-3-methylbutan-1-ol |
| SMILES | Cc1ccc(S(=O)(=O)C(CO)C(C)C)c(C)c1 |
| InChI | InChI=1S/C13H20O3S/c1-9(2)13(8-14)17(15,16)12-6-5-10(3)7-11(12)4/h5-7,9,13-14H,8H2,1-4H3 |
| InChIKey | XKJWCNPAEQLGOL-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.37 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |