C19H28N6O3 — CID 45049466
carbonic acid;bis(2-(2,4-dimethylphenyl)guanidine) (PubChem CID 45049466) has the molecular formula C19H28N6O3 and a molecular weight of 388.47 g/mol. Its IUPAC name is carbonic acid;bis(2-(2,4-dimethylphenyl)guanidine).
| Compound Name | carbonic acid;bis(2-(2,4-dimethylphenyl)guanidine) |
|---|---|
| PubChem CID | 45049466 |
| Molecular Formula | C19H28N6O3 |
| Molecular Weight | 388.47 g/mol |
| Exact Mass | 388.22 |
| IUPAC Name | carbonic acid;bis(2-(2,4-dimethylphenyl)guanidine) |
| SMILES | Cc1ccc(N=C(N)N)c(C)c1.Cc1ccc(N=C(N)N)c(C)c1.O=C(O)O |
| InChI | InChI=1S/2C9H13N3.CH2O3/c2*1-6-3-4-8(7(2)5-6)12-9(10)11;2-1(3)4/h2*3-5H,1-2H3,(H4,10,11,12);(H2,2,3,4) |
| InChIKey | OJVONQKWTTYBCD-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 186.33 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.47 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|