About ethyl 4-chloro-2-[(2,4-dimethylphenyl)diazenyl]-3-hydroxybut-2-enoate
ethyl 4-chloro-2-[(2,4-dimethylphenyl)diazenyl]-3-hydroxybut-2-enoate (PubChem CID 135531055) has the molecular formula C14H17ClN2O3
and a molecular weight of 296.75 g/mol. Its IUPAC name is ethyl 4-chloro-2-[(2,4-dimethylphenyl)diazenyl]-3-hydroxybut-2-enoate.
Molecular Properties
| Compound Name | ethyl 4-chloro-2-[(2,4-dimethylphenyl)diazenyl]-3-hydroxybut-2-enoate |
| PubChem CID | 135531055 |
| Molecular Formula | C14H17ClN2O3 |
| Molecular Weight | 296.75 g/mol |
| Exact Mass | 296.09 |
| IUPAC Name | ethyl 4-chloro-2-[(2,4-dimethylphenyl)diazenyl]-3-hydroxybut-2-enoate |
| SMILES | CCOC(=O)C(/N=N/c1ccc(C)cc1C)=C(O)CCl |
| InChI | InChI=1S/C14H17ClN2O3/c1-4-20-14(19)13(12(18)8-15)17-16-11-6-5-9(2)7-10(11)3/h5-7,18H,4,8H2,1-3H3/b13-12?,17-16+ |
| InChIKey | MWFXWXRROOLMPE-XXCOHAGWSA-N |
| XLogP | 3.96 |
| TPSA | 71.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 296.75 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze ethyl 4-chloro-2-[(2,4-dimethylphenyl)diazenyl]-3-hydroxybut-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 4-chloro-2-[(2,4-dimethylphenyl)diazenyl]-3-hydroxybut-2-enoate?
The IUPAC name of ethyl 4-chloro-2-[(2,4-dimethylphenyl)diazenyl]-3-hydroxybut-2-enoate (CID 135531055) is ethyl 4-chloro-2-[(2,4-dimethylphenyl)diazenyl]-3-hydroxybut-2-enoate.
What is the SMILES notation for ethyl 4-chloro-2-[(2,4-dimethylphenyl)diazenyl]-3-hydroxybut-2-enoate?
The canonical SMILES for ethyl 4-chloro-2-[(2,4-dimethylphenyl)diazenyl]-3-hydroxybut-2-enoate is CCOC(=O)C(/N=N/c1ccc(C)cc1C)=C(O)CCl.
What is the InChIKey of ethyl 4-chloro-2-[(2,4-dimethylphenyl)diazenyl]-3-hydroxybut-2-enoate?
The InChIKey is MWFXWXRROOLMPE-XXCOHAGWSA-N. The full InChI is InChI=1S/C14H17ClN2O3/c1-4-20-14(19)13(12(18)8-15)17-16-11-6-5-9(2)7-10(11)3/h5-7,18H,4,8H2,1-3H3/b13-12?,17-16+.
What are the key properties of ethyl 4-chloro-2-[(2,4-dimethylphenyl)diazenyl]-3-hydroxybut-2-enoate?
ethyl 4-chloro-2-[(2,4-dimethylphenyl)diazenyl]-3-hydroxybut-2-enoate has a molecular weight of 296.75 g/mol, XLogP of 3.96, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 4-chloro-2-[(2,4-dimethylphenyl)diazenyl]-3-hydroxybut-2-enoate is sourced from PubChem (CID 135531055), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).