C36H40CuN4O4 — CID 139084118
copper;bis(methyl N'-(2,4-dimethylphenyl)-N-(4-methylbenzoyl)carbamimidate) (PubChem CID 139084118) has the molecular formula C36H40CuN4O4 and a molecular weight of 656.29 g/mol. Its IUPAC name is copper;bis(methyl N'-(2,4-dimethylphenyl)-N-(4-methylbenzoyl)carbamimidate).
| Compound Name | copper;bis(methyl N'-(2,4-dimethylphenyl)-N-(4-methylbenzoyl)carbamimidate) |
|---|---|
| PubChem CID | 139084118 |
| Molecular Formula | C36H40CuN4O4 |
| Molecular Weight | 656.29 g/mol |
| Exact Mass | 655.23 |
| IUPAC Name | copper;bis(methyl N'-(2,4-dimethylphenyl)-N-(4-methylbenzoyl)carbamimidate) |
| SMILES | CO/C(=N\c1ccc(C)cc1C)NC(=O)c1ccc(C)cc1.CO/C(=N\c1ccc(C)cc1C)NC(=O)c1ccc(C)cc1.[Cu] |
| InChI | InChI=1S/2C18H20N2O2.Cu/c2*1-12-5-8-15(9-6-12)17(21)20-18(22-4)19-16-10-7-13(2)11-14(16)3;/h2*5-11H,1-4H3,(H,19,20,21); |
| InChIKey | FAGZNLGGQFTTIM-UHFFFAOYSA-N |
| XLogP | 7.35 |
| TPSA | 101.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 656.29 |
| LogP ≤ 5 | 7.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|