About ethylsulfanyl N-carbamoylcarbamate
ethylsulfanyl N-carbamoylcarbamate (PubChem CID 87478497) has the molecular formula C4H8N2O3S
and a molecular weight of 164.19 g/mol. Its IUPAC name is ethylsulfanyl N-carbamoylcarbamate.
Molecular Properties
| Compound Name | ethylsulfanyl N-carbamoylcarbamate |
| PubChem CID | 87478497 |
| Molecular Formula | C4H8N2O3S |
| Molecular Weight | 164.19 g/mol |
| Exact Mass | 164.03 |
| IUPAC Name | ethylsulfanyl N-carbamoylcarbamate |
| SMILES | CCSOC(=O)NC(N)=O |
| InChI | InChI=1S/C4H8N2O3S/c1-2-10-9-4(8)6-3(5)7/h2H2,1H3,(H3,5,6,7,8) |
| InChIKey | JNQBEFCFNVOWSQ-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 164.19 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze ethylsulfanyl N-carbamoylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethylsulfanyl N-carbamoylcarbamate?
The IUPAC name of ethylsulfanyl N-carbamoylcarbamate (CID 87478497) is ethylsulfanyl N-carbamoylcarbamate.
What is the SMILES notation for ethylsulfanyl N-carbamoylcarbamate?
The canonical SMILES for ethylsulfanyl N-carbamoylcarbamate is CCSOC(=O)NC(N)=O.
What is the InChIKey of ethylsulfanyl N-carbamoylcarbamate?
The InChIKey is JNQBEFCFNVOWSQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H8N2O3S/c1-2-10-9-4(8)6-3(5)7/h2H2,1H3,(H3,5,6,7,8).
What are the key properties of ethylsulfanyl N-carbamoylcarbamate?
ethylsulfanyl N-carbamoylcarbamate has a molecular weight of 164.19 g/mol, XLogP of 0.46, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethylsulfanyl N-carbamoylcarbamate is sourced from PubChem (CID 87478497), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).