About potassium ethylsulfanyl carbonate
potassium ethylsulfanyl carbonate (PubChem CID 23686326) has the molecular formula C3H5KO3S
and a molecular weight of 160.23 g/mol. Its IUPAC name is potassium ethylsulfanyl carbonate.
Molecular Properties
| Compound Name | potassium ethylsulfanyl carbonate |
| PubChem CID | 23686326 |
| Molecular Formula | C3H5KO3S |
| Molecular Weight | 160.23 g/mol |
| Exact Mass | 159.96 |
| IUPAC Name | potassium ethylsulfanyl carbonate |
| SMILES | CCSOC(=O)[O-].[K+] |
| InChI | InChI=1S/C3H6O3S.K/c1-2-7-6-3(4)5;/h2H2,1H3,(H,4,5);/q;+1/p-1 |
| InChIKey | MJKILGOYUWTMRN-UHFFFAOYSA-M |
| XLogP | -2.98 |
| TPSA | 49.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 160.23 |
| LogP ≤ 5 | -2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze potassium ethylsulfanyl carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of potassium ethylsulfanyl carbonate?
The IUPAC name of potassium ethylsulfanyl carbonate (CID 23686326) is potassium ethylsulfanyl carbonate.
What is the SMILES notation for potassium ethylsulfanyl carbonate?
The canonical SMILES for potassium ethylsulfanyl carbonate is CCSOC(=O)[O-].[K+].
What is the InChIKey of potassium ethylsulfanyl carbonate?
The InChIKey is MJKILGOYUWTMRN-UHFFFAOYSA-M. The full InChI is InChI=1S/C3H6O3S.K/c1-2-7-6-3(4)5;/h2H2,1H3,(H,4,5);/q;+1/p-1.
What are the key properties of potassium ethylsulfanyl carbonate?
potassium ethylsulfanyl carbonate has a molecular weight of 160.23 g/mol, XLogP of -2.98, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for potassium ethylsulfanyl carbonate is sourced from PubChem (CID 23686326), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).