About 3-(diethylamino)hexyl carbamate
3-(diethylamino)hexyl carbamate (PubChem CID 88732778) has the molecular formula C11H24N2O2
and a molecular weight of 216.32 g/mol. Its IUPAC name is 3-(diethylamino)hexyl carbamate.
Molecular Properties
| Compound Name | 3-(diethylamino)hexyl carbamate |
| PubChem CID | 88732778 |
| Molecular Formula | C11H24N2O2 |
| Molecular Weight | 216.32 g/mol |
| Exact Mass | 216.18 |
| IUPAC Name | 3-(diethylamino)hexyl carbamate |
| SMILES | CCCC(CCOC(N)=O)N(CC)CC |
| InChI | InChI=1S/C11H24N2O2/c1-4-7-10(13(5-2)6-3)8-9-15-11(12)14/h10H,4-9H2,1-3H3,(H2,12,14) |
| InChIKey | RLKKQYJBKVOPES-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.32 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-(diethylamino)hexyl carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(diethylamino)hexyl carbamate?
The IUPAC name of 3-(diethylamino)hexyl carbamate (CID 88732778) is 3-(diethylamino)hexyl carbamate.
What is the SMILES notation for 3-(diethylamino)hexyl carbamate?
The canonical SMILES for 3-(diethylamino)hexyl carbamate is CCCC(CCOC(N)=O)N(CC)CC.
What is the InChIKey of 3-(diethylamino)hexyl carbamate?
The InChIKey is RLKKQYJBKVOPES-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H24N2O2/c1-4-7-10(13(5-2)6-3)8-9-15-11(12)14/h10H,4-9H2,1-3H3,(H2,12,14).
What are the key properties of 3-(diethylamino)hexyl carbamate?
3-(diethylamino)hexyl carbamate has a molecular weight of 216.32 g/mol, XLogP of 1.98, 8 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(diethylamino)hexyl carbamate is sourced from PubChem (CID 88732778), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).