C18H35NO2 — CID 102118085
7-(diethylamino)decyl 2-methylprop-2-enoate (PubChem CID 102118085) has the molecular formula C18H35NO2 and a molecular weight of 297.48 g/mol. Its IUPAC name is 7-(diethylamino)decyl 2-methylprop-2-enoate.
| Compound Name | 7-(diethylamino)decyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 102118085 |
| Molecular Formula | C18H35NO2 |
| Molecular Weight | 297.48 g/mol |
| Exact Mass | 297.27 |
| IUPAC Name | 7-(diethylamino)decyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCCCCCC(CCC)N(CC)CC |
| InChI | InChI=1S/C18H35NO2/c1-6-13-17(19(7-2)8-3)14-11-9-10-12-15-21-18(20)16(4)5/h17H,4,6-15H2,1-3,5H3 |
| InChIKey | PPBCDSUTTSKBLI-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.48 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|