C19H37NO2 — CID 102118100
4-(dipropylamino)nonyl 2-methylprop-2-enoate (PubChem CID 102118100) has the molecular formula C19H37NO2 and a molecular weight of 311.51 g/mol. Its IUPAC name is 4-(dipropylamino)nonyl 2-methylprop-2-enoate.
| Compound Name | 4-(dipropylamino)nonyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 102118100 |
| Molecular Formula | C19H37NO2 |
| Molecular Weight | 311.51 g/mol |
| Exact Mass | 311.28 |
| IUPAC Name | 4-(dipropylamino)nonyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCCC(CCCCC)N(CCC)CCC |
| InChI | InChI=1S/C19H37NO2/c1-6-9-10-12-18(20(14-7-2)15-8-3)13-11-16-22-19(21)17(4)5/h18H,4,6-16H2,1-3,5H3 |
| InChIKey | ACYNLXCZWCKZFJ-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.51 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|