C20H38O2 — CID 151688147
4-tert-butyldodecyl 2-methylprop-2-enoate (PubChem CID 151688147) has the molecular formula C20H38O2 and a molecular weight of 310.52 g/mol. Its IUPAC name is 4-tert-butyldodecyl 2-methylprop-2-enoate.
| Compound Name | 4-tert-butyldodecyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 151688147 |
| Molecular Formula | C20H38O2 |
| Molecular Weight | 310.52 g/mol |
| Exact Mass | 310.29 |
| IUPAC Name | 4-tert-butyldodecyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCCC(CCCCCCCC)C(C)(C)C |
| InChI | InChI=1S/C20H38O2/c1-7-8-9-10-11-12-14-18(20(4,5)6)15-13-16-22-19(21)17(2)3/h18H,2,7-16H2,1,3-6H3 |
| InChIKey | RBZFMECVRQFAFI-UHFFFAOYSA-N |
| XLogP | 6.30 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.52 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|